C14H23NO2Si — CID 101420020
N-(4-hydroxyphenyl)-2-triethylsilylacetamide (PubChem CID 101420020) has the molecular formula C14H23NO2Si and a molecular weight of 265.43 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2-triethylsilylacetamide.
| Compound Name | N-(4-hydroxyphenyl)-2-triethylsilylacetamide |
|---|---|
| PubChem CID | 101420020 |
| Molecular Formula | C14H23NO2Si |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | N-(4-hydroxyphenyl)-2-triethylsilylacetamide |
| SMILES | CC[Si](CC)(CC)CC(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C14H23NO2Si/c1-4-18(5-2,6-3)11-14(17)15-12-7-9-13(16)10-8-12/h7-10,16H,4-6,11H2,1-3H3,(H,15,17) |
| InChIKey | IGDLGGQNKXIIGR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|