C35H54O6 — CID 101420445
[(3R,4R,5R,6R)-4,5-dihydroxy-6-[2-methyl-5-(4-prop-1-en-2-ylcyclohexen-1-yl)pentoxy]oxan-3-yl] (E)-2-methyl-5-(4-prop-1-en-2-ylcyclohexen-1-yl)pent-2-enoate (PubChem CID 101420445) has the molecular formula C35H54O6 and a molecular weight of 570.81 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-4,5-dihydroxy-6-[2-methyl-5-(4-prop-1-en-2-ylcyclohexen-1-yl)pentoxy]oxan-3-yl] (E)-2-methyl-5-(4-prop-1-en-2-ylcyclohexen-1-yl)pent-2-enoate.
| Compound Name | [(3R,4R,5R,6R)-4,5-dihydroxy-6-[2-methyl-5-(4-prop-1-en-2-ylcyclohexen-1-yl)pentoxy]oxan-3-yl] (E)-2-methyl-5-(4-prop-1-en-2-ylcyclohexen-1-yl)pent-2-enoate |
|---|---|
| PubChem CID | 101420445 |
| Molecular Formula | C35H54O6 |
| Molecular Weight | 570.81 g/mol |
| Exact Mass | 570.39 |
| IUPAC Name | [(3R,4R,5R,6R)-4,5-dihydroxy-6-[2-methyl-5-(4-prop-1-en-2-ylcyclohexen-1-yl)pentoxy]oxan-3-yl] (E)-2-methyl-5-(4-prop-1-en-2-ylcyclohexen-1-yl)pent-2-enoate |
| SMILES | C=C(C)C1CC=C(CC/C=C(\C)C(=O)O[C@@H]2CO[C@@H](OCC(C)CCCC3=CCC(C(=C)C)CC3)[C@H](O)[C@H]2O)CC1 |
| InChI | InChI=1S/C35H54O6/c1-23(2)29-17-13-27(14-18-29)11-7-9-25(5)21-39-35-33(37)32(36)31(22-40-35)41-34(38)26(6)10-8-12-28-15-19-30(20-16-28)24(3)4/h10,13,15,25,29-33,35-37H,1,3,7-9,11-12,14,16-22H2,2,4-6H3/b26-10+/t25?,29?,30?,31-,32+,33-,35-/m1/s1 |
| InChIKey | RYXWJNUZKCVUBO-SJVLASJKSA-N |
| XLogP | 7.13 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.81 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|