C10H9Cl3FNO4S — CID 101420581
2,2,2-trichloroethyl N-[2-(4-fluorophenyl)-2-oxoethyl]sulfamate (PubChem CID 101420581) has the molecular formula C10H9Cl3FNO4S and a molecular weight of 364.61 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[2-(4-fluorophenyl)-2-oxoethyl]sulfamate.
| Compound Name | 2,2,2-trichloroethyl N-[2-(4-fluorophenyl)-2-oxoethyl]sulfamate |
|---|---|
| PubChem CID | 101420581 |
| Molecular Formula | C10H9Cl3FNO4S |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 362.93 |
| IUPAC Name | 2,2,2-trichloroethyl N-[2-(4-fluorophenyl)-2-oxoethyl]sulfamate |
| SMILES | O=C(CNS(=O)(=O)OCC(Cl)(Cl)Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H9Cl3FNO4S/c11-10(12,13)6-19-20(17,18)15-5-9(16)7-1-3-8(14)4-2-7/h1-4,15H,5-6H2 |
| InChIKey | DKSXNEBKLQNRAL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|