C44H81NO16P+ — CID 101420951
2-[[(2R)-2,3-bis[8-(8-ethoxy-8-oxooctanoyl)oxyoctanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 101420951) has the molecular formula C44H81NO16P+ and a molecular weight of 911.10 g/mol. Its IUPAC name is 2-[[(2R)-2,3-bis[8-(8-ethoxy-8-oxooctanoyl)oxyoctanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2,3-bis[8-(8-ethoxy-8-oxooctanoyl)oxyoctanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 101420951 |
| Molecular Formula | C44H81NO16P+ |
| Molecular Weight | 911.10 g/mol |
| Exact Mass | 910.53 |
| IUPAC Name | 2-[[(2R)-2,3-bis[8-(8-ethoxy-8-oxooctanoyl)oxyoctanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCOC(=O)CCCCCCC(=O)OCCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCOC(=O)CCCCCCC(=O)OCC |
| InChI | InChI=1S/C44H80NO16P/c1-6-54-39(46)26-19-12-14-21-28-41(48)56-33-24-16-8-10-18-30-43(50)58-36-38(37-60-62(52,53)59-35-32-45(3,4)5)61-44(51)31-23-11-9-17-25-34-57-42(49)29-22-15-13-20-27-40(47)55-7-2/h38H,6-37H2,1-5H3/p+1/t38-/m1/s1 |
| InChIKey | JAYVFYAYOHDLPM-KXQOOQHDSA-O |
| XLogP | 7.86 |
| TPSA | 213.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.10 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|