C13H7F4NO2 — CID 101421663
6-methyl-4-oxo-2-(1,1,2,2-tetrafluoroethyl)chromene-3-carbonitrile (PubChem CID 101421663) has the molecular formula C13H7F4NO2 and a molecular weight of 285.20 g/mol. Its IUPAC name is 6-methyl-4-oxo-2-(1,1,2,2-tetrafluoroethyl)chromene-3-carbonitrile.
| Compound Name | 6-methyl-4-oxo-2-(1,1,2,2-tetrafluoroethyl)chromene-3-carbonitrile |
|---|---|
| PubChem CID | 101421663 |
| Molecular Formula | C13H7F4NO2 |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 6-methyl-4-oxo-2-(1,1,2,2-tetrafluoroethyl)chromene-3-carbonitrile |
| SMILES | Cc1ccc2oc(C(F)(F)C(F)F)c(C#N)c(=O)c2c1 |
| InChI | InChI=1S/C13H7F4NO2/c1-6-2-3-9-7(4-6)10(19)8(5-18)11(20-9)13(16,17)12(14)15/h2-4,12H,1H3 |
| InChIKey | KBRUJQROLXYTRG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|