C30H26O12 — CID 101422266
4-[[2-(3,4-dihydroxyphenyl)-3,7,8-trihydroxy-3,4-dihydro-2H-chromen-4-yl]oxy]-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,7,8-triol (PubChem CID 101422266) has the molecular formula C30H26O12 and a molecular weight of 578.53 g/mol. Its IUPAC name is 4-[[2-(3,4-dihydroxyphenyl)-3,7,8-trihydroxy-3,4-dihydro-2H-chromen-4-yl]oxy]-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,7,8-triol.
| Compound Name | 4-[[2-(3,4-dihydroxyphenyl)-3,7,8-trihydroxy-3,4-dihydro-2H-chromen-4-yl]oxy]-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,7,8-triol |
|---|---|
| PubChem CID | 101422266 |
| Molecular Formula | C30H26O12 |
| Molecular Weight | 578.53 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | 4-[[2-(3,4-dihydroxyphenyl)-3,7,8-trihydroxy-3,4-dihydro-2H-chromen-4-yl]oxy]-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,7,8-triol |
| SMILES | Oc1ccc(C2Oc3c(ccc(O)c3O)C(OC3c4ccc(O)c(O)c4OC(c4ccc(O)c(O)c4)C3O)C2O)cc1 |
| InChI | InChI=1S/C30H26O12/c31-14-4-1-12(2-5-14)25-23(38)29(15-6-9-18(33)21(36)27(15)40-25)42-30-16-7-10-19(34)22(37)28(16)41-26(24(30)39)13-3-8-17(32)20(35)11-13/h1-11,23-26,29-39H |
| InChIKey | JKYOAXJUOXSWNA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 209.76 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|