C30H26O12 — CID 162858835
(2R,3R,4R)-2-(4-hydroxyphenyl)-6-[(2R,3R,4S)-3,4,7,8-tetrahydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-6-yl]-3,4-dihydro-2H-chromene-3,4,7,8-tetrol (PubChem CID 162858835) has the molecular formula C30H26O12 and a molecular weight of 578.53 g/mol. Its IUPAC name is (2R,3R,4R)-2-(4-hydroxyphenyl)-6-[(2R,3R,4S)-3,4,7,8-tetrahydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-6-yl]-3,4-dihydro-2H-chromene-3,4,7,8-tetrol.
| Compound Name | (2R,3R,4R)-2-(4-hydroxyphenyl)-6-[(2R,3R,4S)-3,4,7,8-tetrahydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-6-yl]-3,4-dihydro-2H-chromene-3,4,7,8-tetrol |
|---|---|
| PubChem CID | 162858835 |
| Molecular Formula | C30H26O12 |
| Molecular Weight | 578.53 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | (2R,3R,4R)-2-(4-hydroxyphenyl)-6-[(2R,3R,4S)-3,4,7,8-tetrahydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-6-yl]-3,4-dihydro-2H-chromene-3,4,7,8-tetrol |
| SMILES | Oc1ccc([C@H]2Oc3c(cc(-c4cc5c(c(O)c4O)O[C@H](c4ccc(O)cc4)[C@H](O)[C@H]5O)c(O)c3O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C30H26O12/c31-13-5-1-11(2-6-13)27-23(37)21(35)17-9-15(19(33)25(39)29(17)41-27)16-10-18-22(36)24(38)28(12-3-7-14(32)8-4-12)42-30(18)26(40)20(16)34/h1-10,21-24,27-28,31-40H/t21-,22+,23-,24-,27-,28-/m1/s1 |
| InChIKey | OIDGTXPFGQJCKF-KRXZIQNWSA-N |
| XLogP | 2.64 |
| TPSA | 220.76 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|