C15H14O5 — CID 101141276
2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,7-triol (PubChem CID 101141276) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,7-triol.
| Compound Name | 2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,7-triol |
|---|---|
| PubChem CID | 101141276 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,7-triol |
| SMILES | Oc1cccc(C2Oc3cc(O)ccc3C(O)C2O)c1 |
| InChI | InChI=1S/C15H14O5/c16-9-3-1-2-8(6-9)15-14(19)13(18)11-5-4-10(17)7-12(11)20-15/h1-7,13-19H |
| InChIKey | PTZZKNJHKJIMTN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |