C15H14O5 — CID 66548355
2-phenyl-3,4-dihydro-2H-chromene-3,4,5,7-tetrol (PubChem CID 66548355) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is 2-phenyl-3,4-dihydro-2H-chromene-3,4,5,7-tetrol.
| Compound Name | 2-phenyl-3,4-dihydro-2H-chromene-3,4,5,7-tetrol |
|---|---|
| PubChem CID | 66548355 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-phenyl-3,4-dihydro-2H-chromene-3,4,5,7-tetrol |
| SMILES | Oc1cc(O)c2c(c1)OC(c1ccccc1)C(O)C2O |
| InChI | InChI=1S/C15H14O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,13-19H |
| InChIKey | MTOGKBVCUVCNIM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |