C15H14O6 — CID 70700187
2-phenyl-2,4-dihydrochromene-3,3,4,5,7-pentol (PubChem CID 70700187) has the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. Its IUPAC name is 2-phenyl-2,4-dihydrochromene-3,3,4,5,7-pentol.
| Compound Name | 2-phenyl-2,4-dihydrochromene-3,3,4,5,7-pentol |
|---|---|
| PubChem CID | 70700187 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-phenyl-2,4-dihydrochromene-3,3,4,5,7-pentol |
| SMILES | Oc1cc(O)c2c(c1)OC(c1ccccc1)C(O)(O)C2O |
| InChI | InChI=1S/C15H14O6/c16-9-6-10(17)12-11(7-9)21-14(15(19,20)13(12)18)8-4-2-1-3-5-8/h1-7,13-14,16-20H |
| InChIKey | AKDVYNSLZXOGKU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|