C22H20O7S — CID 93477121
(2R,3S,4S)-4-benzylsulfanyl-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol (PubChem CID 93477121) has the molecular formula C22H20O7S and a molecular weight of 428.46 g/mol. Its IUPAC name is (2R,3S,4S)-4-benzylsulfanyl-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol.
| Compound Name | (2R,3S,4S)-4-benzylsulfanyl-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 93477121 |
| Molecular Formula | C22H20O7S |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | (2R,3S,4S)-4-benzylsulfanyl-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1cc(O)c(O)c(O)c1)[C@H](O)[C@H]2SCc1ccccc1 |
| InChI | InChI=1S/C22H20O7S/c23-13-8-14(24)18-17(9-13)29-21(12-6-15(25)19(27)16(26)7-12)20(28)22(18)30-10-11-4-2-1-3-5-11/h1-9,20-28H,10H2/t20-,21+,22-/m0/s1 |
| InChIKey | XCHZDDFXJYXEFZ-BDTNDASRSA-N |
| XLogP | 3.68 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|