C13H12O4 — CID 124565841
(2R,4S)-2-(furan-2-yl)-3,4-dihydro-2H-chromene-4,7-diol (PubChem CID 124565841) has the molecular formula C13H12O4 and a molecular weight of 232.24 g/mol. Its IUPAC name is (2R,4S)-2-(furan-2-yl)-3,4-dihydro-2H-chromene-4,7-diol.
| Compound Name | (2R,4S)-2-(furan-2-yl)-3,4-dihydro-2H-chromene-4,7-diol |
|---|---|
| PubChem CID | 124565841 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (2R,4S)-2-(furan-2-yl)-3,4-dihydro-2H-chromene-4,7-diol |
| SMILES | Oc1ccc2c(c1)O[C@@H](c1ccco1)C[C@@H]2O |
| InChI | InChI=1S/C13H12O4/c14-8-3-4-9-10(15)7-13(17-12(9)6-8)11-2-1-5-16-11/h1-6,10,13-15H,7H2/t10-,13+/m0/s1 |
| InChIKey | DDCCYDLROVRJDO-GXFFZTMASA-N |
| XLogP | 2.54 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |