C30H26O10 — CID 14540817
(2R,3S)-2-(3,4-dihydroxyphenyl)-6-[(2R,3S,4S)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,7-diol (PubChem CID 14540817) has the molecular formula C30H26O10 and a molecular weight of 546.53 g/mol. Its IUPAC name is (2R,3S)-2-(3,4-dihydroxyphenyl)-6-[(2R,3S,4S)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,7-diol.
| Compound Name | (2R,3S)-2-(3,4-dihydroxyphenyl)-6-[(2R,3S,4S)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,7-diol |
|---|---|
| PubChem CID | 14540817 |
| Molecular Formula | C30H26O10 |
| Molecular Weight | 546.53 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | (2R,3S)-2-(3,4-dihydroxyphenyl)-6-[(2R,3S,4S)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,7-diol |
| SMILES | Oc1ccc2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)[C@H]2c1cc2c(cc1O)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C30H26O10/c31-16-3-4-17-26(11-16)40-30(14-2-6-20(33)23(36)9-14)28(38)27(17)18-7-15-10-24(37)29(39-25(15)12-21(18)34)13-1-5-19(32)22(35)8-13/h1-9,11-12,24,27-38H,10H2/t24-,27+,28-,29+,30+/m0/s1 |
| InChIKey | VHQVNGHQNYUUBC-NWQMJODPSA-N |
| XLogP | 3.58 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|