C31H26O10 — CID 162978909
(6aS,7R,12aS)-7-[(2S,3S)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-6-yl]-5,6a,7,12a-tetrahydroisochromeno[4,3-b]chromene-3,4,10-triol (PubChem CID 162978909) has the molecular formula C31H26O10 and a molecular weight of 558.54 g/mol. Its IUPAC name is (6aS,7R,12aS)-7-[(2S,3S)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-6-yl]-5,6a,7,12a-tetrahydroisochromeno[4,3-b]chromene-3,4,10-triol.
| Compound Name | (6aS,7R,12aS)-7-[(2S,3S)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-6-yl]-5,6a,7,12a-tetrahydroisochromeno[4,3-b]chromene-3,4,10-triol |
|---|---|
| PubChem CID | 162978909 |
| Molecular Formula | C31H26O10 |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | (6aS,7R,12aS)-7-[(2S,3S)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-6-yl]-5,6a,7,12a-tetrahydroisochromeno[4,3-b]chromene-3,4,10-triol |
| SMILES | Oc1ccc2c(c1)O[C@H]1c3ccc(O)c(O)c3CO[C@H]1[C@@H]2c1cc2c(cc1O)O[C@@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C31H26O10/c32-15-2-3-17-26(10-15)41-30-16-4-6-21(34)28(38)19(16)12-39-31(30)27(17)18-7-14-9-24(37)29(40-25(14)11-22(18)35)13-1-5-20(33)23(36)8-13/h1-8,10-11,24,27,29-38H,9,12H2/t24-,27-,29-,30-,31-/m0/s1 |
| InChIKey | HZFYVKDRLFXOOF-PWSKELSHSA-N |
| XLogP | 4.12 |
| TPSA | 169.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|