C30H26O9 — CID 162972223
(2R,3S)-6-[(2R,3S,4S)-3,7-dihydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,7-diol (PubChem CID 162972223) has the molecular formula C30H26O9 and a molecular weight of 530.53 g/mol. Its IUPAC name is (2R,3S)-6-[(2R,3S,4S)-3,7-dihydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,7-diol.
| Compound Name | (2R,3S)-6-[(2R,3S,4S)-3,7-dihydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,7-diol |
|---|---|
| PubChem CID | 162972223 |
| Molecular Formula | C30H26O9 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | (2R,3S)-6-[(2R,3S,4S)-3,7-dihydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,7-diol |
| SMILES | Oc1ccc([C@H]2Oc3cc(O)ccc3[C@H](c3cc4c(cc3O)O[C@H](c3ccc(O)c(O)c3)[C@@H](O)C4)[C@@H]2O)cc1 |
| InChI | InChI=1S/C30H26O9/c31-17-4-1-14(2-5-17)30-28(37)27(19-7-6-18(32)12-26(19)39-30)20-9-16-11-24(36)29(38-25(16)13-22(20)34)15-3-8-21(33)23(35)10-15/h1-10,12-13,24,27-37H,11H2/t24-,27+,28-,29+,30+/m0/s1 |
| InChIKey | FPHINTVIWMLKSF-NWQMJODPSA-N |
| XLogP | 3.88 |
| TPSA | 160.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|