C16H20N2O2S — CID 101423249
ethyl (2E)-3-(benzylamino)-2-pyrrolidin-2-ylidene-3-sulfanylidenepropanoate (PubChem CID 101423249) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is ethyl (2E)-3-(benzylamino)-2-pyrrolidin-2-ylidene-3-sulfanylidenepropanoate.
| Compound Name | ethyl (2E)-3-(benzylamino)-2-pyrrolidin-2-ylidene-3-sulfanylidenepropanoate |
|---|---|
| PubChem CID | 101423249 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | ethyl (2E)-3-(benzylamino)-2-pyrrolidin-2-ylidene-3-sulfanylidenepropanoate |
| SMILES | CCOC(=O)/C(C(=S)NCc1ccccc1)=C1/CCCN1 |
| InChI | InChI=1S/C16H20N2O2S/c1-2-20-16(19)14(13-9-6-10-17-13)15(21)18-11-12-7-4-3-5-8-12/h3-5,7-8,17H,2,6,9-11H2,1H3,(H,18,21)/b14-13- |
| InChIKey | DXTQTMDJUNXQDA-YPKPFQOOSA-N |
| XLogP | 2.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|