C18H22N4O2S — CID 979831
ethyl 2-(benzylcarbamothioylamino)-4,5,6,7-tetrahydrobenzimidazole-1-carboxylate (PubChem CID 979831) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is ethyl 2-(benzylcarbamothioylamino)-4,5,6,7-tetrahydrobenzimidazole-1-carboxylate.
| Compound Name | ethyl 2-(benzylcarbamothioylamino)-4,5,6,7-tetrahydrobenzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 979831 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | ethyl 2-(benzylcarbamothioylamino)-4,5,6,7-tetrahydrobenzimidazole-1-carboxylate |
| SMILES | CCOC(=O)n1c(NC(=S)NCc2ccccc2)nc2c1CCCC2 |
| InChI | InChI=1S/C18H22N4O2S/c1-2-24-18(23)22-15-11-7-6-10-14(15)20-16(22)21-17(25)19-12-13-8-4-3-5-9-13/h3-5,8-9H,2,6-7,10-12H2,1H3,(H2,19,20,21,25) |
| InChIKey | NMUVWFXFAFKOCL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|