C18H20FN5O2S — CID 6260779
ethyl 2-[[(Z)-(4-fluorophenyl)methylideneamino]carbamothioylamino]-4,5,6,7-tetrahydrobenzimidazole-1-carboxylate (PubChem CID 6260779) has the molecular formula C18H20FN5O2S and a molecular weight of 389.46 g/mol. Its IUPAC name is ethyl 2-[[(Z)-(4-fluorophenyl)methylideneamino]carbamothioylamino]-4,5,6,7-tetrahydrobenzimidazole-1-carboxylate.
| Compound Name | ethyl 2-[[(Z)-(4-fluorophenyl)methylideneamino]carbamothioylamino]-4,5,6,7-tetrahydrobenzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 6260779 |
| Molecular Formula | C18H20FN5O2S |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | ethyl 2-[[(Z)-(4-fluorophenyl)methylideneamino]carbamothioylamino]-4,5,6,7-tetrahydrobenzimidazole-1-carboxylate |
| SMILES | CCOC(=O)n1c(NC(=S)N/N=C\c2ccc(F)cc2)nc2c1CCCC2 |
| InChI | InChI=1S/C18H20FN5O2S/c1-2-26-18(25)24-15-6-4-3-5-14(15)21-16(24)22-17(27)23-20-11-12-7-9-13(19)10-8-12/h7-11H,2-6H2,1H3,(H2,21,22,23,27)/b20-11- |
| InChIKey | FINNNLCYCVYJKV-JAIQZWGSSA-N |
| XLogP | 3.23 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|