C24H26N2P+ — CID 101424144
[5-(3-tert-butylimidazol-1-ium-1-yl)cyclopenta-1,3-dien-1-yl]-diphenylphosphane (PubChem CID 101424144) has the molecular formula C24H26N2P+ and a molecular weight of 373.46 g/mol. Its IUPAC name is [5-(3-tert-butylimidazol-1-ium-1-yl)cyclopenta-1,3-dien-1-yl]-diphenylphosphane.
| Compound Name | [5-(3-tert-butylimidazol-1-ium-1-yl)cyclopenta-1,3-dien-1-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 101424144 |
| Molecular Formula | C24H26N2P+ |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | [5-(3-tert-butylimidazol-1-ium-1-yl)cyclopenta-1,3-dien-1-yl]-diphenylphosphane |
| SMILES | CC(C)(C)n1cc[n+](C2C=CC=C2P(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H26N2P/c1-24(2,3)26-18-17-25(19-26)22-15-10-16-23(22)27(20-11-6-4-7-12-20)21-13-8-5-9-14-21/h4-19,22H,1-3H3/q+1 |
| InChIKey | GKAWUIGLEHBFNY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|