C28H36N2O10 — CID 101427066
2-[[(4S,5R)-4,5-dihydroxyoxan-2-yl]-methoxyamino]-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide (PubChem CID 101427066) has the molecular formula C28H36N2O10 and a molecular weight of 560.60 g/mol. Its IUPAC name is 2-[[(4S,5R)-4,5-dihydroxyoxan-2-yl]-methoxyamino]-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide.
| Compound Name | 2-[[(4S,5R)-4,5-dihydroxyoxan-2-yl]-methoxyamino]-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
|---|---|
| PubChem CID | 101427066 |
| Molecular Formula | C28H36N2O10 |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | 2-[[(4S,5R)-4,5-dihydroxyoxan-2-yl]-methoxyamino]-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(OC)c(=O)cc1[C@@H](NC(=O)CN(OC)C1C[C@H](O)[C@H](O)CO1)CC2 |
| InChI | InChI=1S/C28H36N2O10/c1-35-22-9-7-16-17(11-20(22)32)18(8-6-15-10-23(36-2)27(37-3)28(38-4)26(15)16)29-24(34)13-30(39-5)25-12-19(31)21(33)14-40-25/h7,9-11,18-19,21,25,31,33H,6,8,12-14H2,1-5H3,(H,29,34)/t18-,19-,21+,25?/m0/s1 |
| InChIKey | KGDNOWOSVLNFRV-MINIGGCTSA-N |
| XLogP | 1.18 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|