C21H17Br2NO3S — CID 10142878
3-(9-bromo-2,3-dimethylbenzo[f][1]benzothiol-4-yl)-5-(bromomethoxy)-N-hydroxybenzeneamine oxide (PubChem CID 10142878) has the molecular formula C21H17Br2NO3S and a molecular weight of 523.25 g/mol. Its IUPAC name is 3-(9-bromo-2,3-dimethylbenzo[f][1]benzothiol-4-yl)-5-(bromomethoxy)-N-hydroxybenzeneamine oxide.
| Compound Name | 3-(9-bromo-2,3-dimethylbenzo[f][1]benzothiol-4-yl)-5-(bromomethoxy)-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 10142878 |
| Molecular Formula | C21H17Br2NO3S |
| Molecular Weight | 523.25 g/mol |
| Exact Mass | 520.93 |
| IUPAC Name | 3-(9-bromo-2,3-dimethylbenzo[f][1]benzothiol-4-yl)-5-(bromomethoxy)-N-hydroxybenzeneamine oxide |
| SMILES | Cc1sc2c(Br)c3ccccc3c(-c3cc(OCBr)cc([NH+]([O-])O)c3)c2c1C |
| InChI | InChI=1S/C21H17Br2NO3S/c1-11-12(2)28-21-18(11)19(16-5-3-4-6-17(16)20(21)23)13-7-14(24(25)26)9-15(8-13)27-10-22/h3-9,24-25H,10H2,1-2H3 |
| InChIKey | JUSGTKNCBLNADE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 56.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.25 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|