C17H20F3NO2S — CID 101428840
4-methyl-N-prop-2-ynyl-N-[2-(trifluoromethyl)hex-1-en-3-yl]benzenesulfonamide (PubChem CID 101428840) has the molecular formula C17H20F3NO2S and a molecular weight of 359.41 g/mol. Its IUPAC name is 4-methyl-N-prop-2-ynyl-N-[2-(trifluoromethyl)hex-1-en-3-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-prop-2-ynyl-N-[2-(trifluoromethyl)hex-1-en-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 101428840 |
| Molecular Formula | C17H20F3NO2S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-methyl-N-prop-2-ynyl-N-[2-(trifluoromethyl)hex-1-en-3-yl]benzenesulfonamide |
| SMILES | C#CCN(C(CCC)C(=C)C(F)(F)F)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H20F3NO2S/c1-5-7-16(14(4)17(18,19)20)21(12-6-2)24(22,23)15-10-8-13(3)9-11-15/h2,8-11,16H,4-5,7,12H2,1,3H3 |
| InChIKey | OFMQNWUJPRTDEN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|