C13H11NO — CID 101429242
(1S,10R,13R)-9-azatetracyclo[7.4.1.02,7.010,13]tetradeca-2,4,6,11-tetraen-8-one (PubChem CID 101429242) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is (1S,10R,13R)-9-azatetracyclo[7.4.1.02,7.010,13]tetradeca-2,4,6,11-tetraen-8-one.
| Compound Name | (1S,10R,13R)-9-azatetracyclo[7.4.1.02,7.010,13]tetradeca-2,4,6,11-tetraen-8-one |
|---|---|
| PubChem CID | 101429242 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (1S,10R,13R)-9-azatetracyclo[7.4.1.02,7.010,13]tetradeca-2,4,6,11-tetraen-8-one |
| SMILES | O=C1c2ccccc2[C@H]2CN1[C@@H]1C=C[C@H]21 |
| InChI | InChI=1S/C13H11NO/c15-13-10-4-2-1-3-8(10)11-7-14(13)12-6-5-9(11)12/h1-6,9,11-12H,7H2/t9-,11-,12-/m1/s1 |
| InChIKey | PPCFXEYEEFTYTI-YUSALJHKSA-N |
| XLogP | 1.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|