C20H38N2O2 — CID 101433662
(4S,5R)-1,3-ditert-butyl-4-ethenyl-5-(hexoxymethyl)imidazolidin-2-one (PubChem CID 101433662) has the molecular formula C20H38N2O2 and a molecular weight of 338.54 g/mol. Its IUPAC name is (4S,5R)-1,3-ditert-butyl-4-ethenyl-5-(hexoxymethyl)imidazolidin-2-one.
| Compound Name | (4S,5R)-1,3-ditert-butyl-4-ethenyl-5-(hexoxymethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 101433662 |
| Molecular Formula | C20H38N2O2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.29 |
| IUPAC Name | (4S,5R)-1,3-ditert-butyl-4-ethenyl-5-(hexoxymethyl)imidazolidin-2-one |
| SMILES | C=C[C@H]1[C@H](COCCCCCC)N(C(C)(C)C)C(=O)N1C(C)(C)C |
| InChI | InChI=1S/C20H38N2O2/c1-9-11-12-13-14-24-15-17-16(10-2)21(19(3,4)5)18(23)22(17)20(6,7)8/h10,16-17H,2,9,11-15H2,1,3-8H3/t16-,17-/m0/s1 |
| InChIKey | BDDWKXIWUTYKRW-IRXDYDNUSA-N |
| XLogP | 4.84 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|