C28H34O8 — CID 101434619
methyl (1R,5S,8S,9S,11S,12S)-12-(2-hex-5-ynoxy-2-oxoethoxy)-5-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate (PubChem CID 101434619) has the molecular formula C28H34O8 and a molecular weight of 498.57 g/mol. Its IUPAC name is methyl (1R,5S,8S,9S,11S,12S)-12-(2-hex-5-ynoxy-2-oxoethoxy)-5-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate.
| Compound Name | methyl (1R,5S,8S,9S,11S,12S)-12-(2-hex-5-ynoxy-2-oxoethoxy)-5-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate |
|---|---|
| PubChem CID | 101434619 |
| Molecular Formula | C28H34O8 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | methyl (1R,5S,8S,9S,11S,12S)-12-(2-hex-5-ynoxy-2-oxoethoxy)-5-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate |
| SMILES | C#CCCCCOC(=O)CO[C@H]1C=C[C@]23OC(=O)[C@@]1(C)C2C(C(=O)OC)[C@]12CC(=C)[C@](O)(CCC13)C2 |
| InChI | InChI=1S/C28H34O8/c1-5-6-7-8-13-34-20(29)15-35-19-10-12-28-18-9-11-27(32)16-26(18,14-17(27)2)21(23(30)33-4)22(28)25(19,3)24(31)36-28/h1,10,12,18-19,21-22,32H,2,6-9,11,13-16H2,3-4H3/t18?,19-,21?,22?,25+,26-,27-,28+/m0/s1 |
| InChIKey | OVEZPASEQXAACM-DKLMHEPYSA-N |
| XLogP | 2.49 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|