C34H38O8 — CID 101434621
methyl (1R,5S,8S,9S,11S,12S)-12-(2-hex-5-ynoxy-2-oxo-1-phenylethoxy)-5-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate (PubChem CID 101434621) has the molecular formula C34H38O8 and a molecular weight of 574.67 g/mol. Its IUPAC name is methyl (1R,5S,8S,9S,11S,12S)-12-(2-hex-5-ynoxy-2-oxo-1-phenylethoxy)-5-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate.
| Compound Name | methyl (1R,5S,8S,9S,11S,12S)-12-(2-hex-5-ynoxy-2-oxo-1-phenylethoxy)-5-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate |
|---|---|
| PubChem CID | 101434621 |
| Molecular Formula | C34H38O8 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | methyl (1R,5S,8S,9S,11S,12S)-12-(2-hex-5-ynoxy-2-oxo-1-phenylethoxy)-5-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate |
| SMILES | C#CCCCCOC(=O)C(O[C@H]1C=C[C@]23OC(=O)[C@@]1(C)C2C(C(=O)OC)[C@]12CC(=C)[C@](O)(CCC13)C2)c1ccccc1 |
| InChI | InChI=1S/C34H38O8/c1-5-6-7-11-18-40-29(36)26(22-12-9-8-10-13-22)41-24-15-17-34-23-14-16-33(38)20-32(23,19-21(33)2)25(28(35)39-4)27(34)31(24,3)30(37)42-34/h1,8-10,12-13,15,17,23-27,38H,2,6-7,11,14,16,18-20H2,3-4H3/t23?,24-,25?,26?,27?,31+,32-,33-,34+/m0/s1 |
| InChIKey | NTAHNCJOZDRMOD-HHBIGQHSSA-N |
| XLogP | 4.23 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|