C30H37BrO6 — CID 101434631
hex-5-ynyl 2-(4-bromophenyl)-2-[[(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl]oxy]acetate (PubChem CID 101434631) has the molecular formula C30H37BrO6 and a molecular weight of 573.52 g/mol. Its IUPAC name is hex-5-ynyl 2-(4-bromophenyl)-2-[[(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl]oxy]acetate.
| Compound Name | hex-5-ynyl 2-(4-bromophenyl)-2-[[(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl]oxy]acetate |
|---|---|
| PubChem CID | 101434631 |
| Molecular Formula | C30H37BrO6 |
| Molecular Weight | 573.52 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | hex-5-ynyl 2-(4-bromophenyl)-2-[[(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl]oxy]acetate |
| SMILES | C#CCCCCOC(=O)C(O[C@@H]1C[C@H]2[C@H](O)/C=C/C(=O)O[C@@H](C)CCC/C=C/[C@@H]2C1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C30H37BrO6/c1-3-4-5-9-18-35-30(34)29(22-12-14-24(31)15-13-22)37-25-19-23-11-8-6-7-10-21(2)36-28(33)17-16-27(32)26(23)20-25/h1,8,11-17,21,23,25-27,29,32H,4-7,9-10,18-20H2,2H3/b11-8+,17-16+/t21-,23+,25-,26+,27+,29?/m0/s1 |
| InChIKey | ZAISMAGMOLFRLS-NVJWLKJHSA-N |
| XLogP | 5.84 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|