C20H24O5 — CID 89240279
(5S)-12-hydroxy-5,11-dimethyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid (PubChem CID 89240279) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (5S)-12-hydroxy-5,11-dimethyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid.
| Compound Name | (5S)-12-hydroxy-5,11-dimethyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid |
|---|---|
| PubChem CID | 89240279 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (5S)-12-hydroxy-5,11-dimethyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid |
| SMILES | C=C1CC23C[C@]1(C)CCC2C12C=CC(O)C(C)(C(=O)O1)C2C3C(=O)O |
| InChI | InChI=1S/C20H24O5/c1-10-8-19-9-17(10,2)6-4-11(19)20-7-5-12(21)18(3,16(24)25-20)14(20)13(19)15(22)23/h5,7,11-14,21H,1,4,6,8-9H2,2-3H3,(H,22,23)/t11?,12?,13?,14?,17-,18?,19?,20?/m0/s1 |
| InChIKey | JXHBGFBFCVSITH-LNHUBHNXSA-N |
| XLogP | 2.30 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|