C27H28Cl2O9 — CID 165360499
3,6-dichloro-2-methoxybenzoic acid;(1R,2R,5R,8S,9S,10R,11S,12S)-5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid (PubChem CID 165360499) has the molecular formula C27H28Cl2O9 and a molecular weight of 567.42 g/mol. Its IUPAC name is 3,6-dichloro-2-methoxybenzoic acid;(1R,2R,5R,8S,9S,10R,11S,12S)-5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid.
| Compound Name | 3,6-dichloro-2-methoxybenzoic acid;(1R,2R,5R,8S,9S,10R,11S,12S)-5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid |
|---|---|
| PubChem CID | 165360499 |
| Molecular Formula | C27H28Cl2O9 |
| Molecular Weight | 567.42 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | 3,6-dichloro-2-methoxybenzoic acid;(1R,2R,5R,8S,9S,10R,11S,12S)-5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid |
| SMILES | C=C1C[C@]23C[C@]1(O)CC[C@H]2[C@@]12C=C[C@H](O)[C@@](C)(C(=O)O1)[C@H]2[C@@H]3C(=O)O.COc1c(Cl)ccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C19H22O6.C8H6Cl2O3/c1-9-7-17-8-18(9,24)5-3-10(17)19-6-4-11(20)16(2,15(23)25-19)13(19)12(17)14(21)22;1-13-7-5(10)3-2-4(9)6(7)8(11)12/h4,6,10-13,20,24H,1,3,5,7-8H2,2H3,(H,21,22);2-3H,1H3,(H,11,12)/t10-,11+,12-,13-,16-,17+,18-,19-;/m1./s1 |
| InChIKey | MCNOXQLCGHZGSY-VOKXJVCWSA-N |
| XLogP | 3.73 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|