C21H24O8 — CID 6711467
(2R,5S,9S,10R,11R,12S)-12-acetyloxy-5-(hydroxymethyl)-11-methyl-6,16-dioxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid (PubChem CID 6711467) has the molecular formula C21H24O8 and a molecular weight of 404.42 g/mol. Its IUPAC name is (2R,5S,9S,10R,11R,12S)-12-acetyloxy-5-(hydroxymethyl)-11-methyl-6,16-dioxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid.
| Compound Name | (2R,5S,9S,10R,11R,12S)-12-acetyloxy-5-(hydroxymethyl)-11-methyl-6,16-dioxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid |
|---|---|
| PubChem CID | 6711467 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (2R,5S,9S,10R,11R,12S)-12-acetyloxy-5-(hydroxymethyl)-11-methyl-6,16-dioxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid |
| SMILES | CC(=O)O[C@H]1C=CC23OC(=O)[C@]1(C)[C@H]2[C@H](C(=O)O)C12CC(=O)[C@@](CO)(CC[C@H]13)C2 |
| InChI | InChI=1S/C21H24O8/c1-10(23)28-13-4-6-21-11-3-5-19(9-22)8-20(11,7-12(19)24)14(16(25)26)15(21)18(13,2)17(27)29-21/h4,6,11,13-15,22H,3,5,7-9H2,1-2H3,(H,25,26)/t11-,13+,14-,15-,18+,19+,20?,21?/m1/s1 |
| InChIKey | UUTJMLLFYZLDSW-FLVARPFASA-N |
| XLogP | 0.86 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|