C22H27ClO6 — CID 23252724
methyl (1R,2R,5S,6S,8S,9S,10R,11S,12S)-12-acetyloxy-6-chloro-5,11-dimethyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate (PubChem CID 23252724) has the molecular formula C22H27ClO6 and a molecular weight of 422.91 g/mol. Its IUPAC name is methyl (1R,2R,5S,6S,8S,9S,10R,11S,12S)-12-acetyloxy-6-chloro-5,11-dimethyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate.
| Compound Name | methyl (1R,2R,5S,6S,8S,9S,10R,11S,12S)-12-acetyloxy-6-chloro-5,11-dimethyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate |
|---|---|
| PubChem CID | 23252724 |
| Molecular Formula | C22H27ClO6 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | methyl (1R,2R,5S,6S,8S,9S,10R,11S,12S)-12-acetyloxy-6-chloro-5,11-dimethyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2[C@@]3(C=C[C@H](OC(C)=O)[C@@]2(C)C(=O)O3)[C@@H]2CC[C@@]3(C)C[C@]21C[C@@H]3Cl |
| InChI | InChI=1S/C22H27ClO6/c1-11(24)28-14-6-8-22-12-5-7-19(2)10-21(12,9-13(19)23)15(17(25)27-4)16(22)20(14,3)18(26)29-22/h6,8,12-16H,5,7,9-10H2,1-4H3/t12-,13+,14+,15-,16-,19+,20-,21-,22-/m1/s1 |
| InChIKey | RVOFGKMCMNXUFI-LOHDOLHASA-N |
| XLogP | 3.01 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|