C16H22O2S — CID 101435461
S-tert-butyl (E,5R)-5-hydroxy-2-methyl-5-phenylpent-2-enethioate (PubChem CID 101435461) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is S-tert-butyl (E,5R)-5-hydroxy-2-methyl-5-phenylpent-2-enethioate.
| Compound Name | S-tert-butyl (E,5R)-5-hydroxy-2-methyl-5-phenylpent-2-enethioate |
|---|---|
| PubChem CID | 101435461 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | S-tert-butyl (E,5R)-5-hydroxy-2-methyl-5-phenylpent-2-enethioate |
| SMILES | C/C(=C\C[C@@H](O)c1ccccc1)C(=O)SC(C)(C)C |
| InChI | InChI=1S/C16H22O2S/c1-12(15(18)19-16(2,3)4)10-11-14(17)13-8-6-5-7-9-13/h5-10,14,17H,11H2,1-4H3/b12-10+/t14-/m1/s1 |
| InChIKey | COHUZYLTVVNKDZ-IEZBTEQYSA-N |
| XLogP | 4.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|