C12H21NO6 — CID 101435584
ethyl (3aS,6R,6aR)-4-amino-6-ethoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carboxylate (PubChem CID 101435584) has the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. Its IUPAC name is ethyl (3aS,6R,6aR)-4-amino-6-ethoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carboxylate.
| Compound Name | ethyl (3aS,6R,6aR)-4-amino-6-ethoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carboxylate |
|---|---|
| PubChem CID | 101435584 |
| Molecular Formula | C12H21NO6 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | ethyl (3aS,6R,6aR)-4-amino-6-ethoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carboxylate |
| SMILES | CCOC(=O)C1(N)O[C@@H](OCC)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C12H21NO6/c1-5-15-9-7-8(18-11(3,4)17-7)12(13,19-9)10(14)16-6-2/h7-9H,5-6,13H2,1-4H3/t7-,8+,9-,12?/m1/s1 |
| InChIKey | ITERLVYXSOEKLM-GJXMVACYSA-N |
| XLogP | 0.12 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |