C18H26N2O2 — CID 101435614
1-[(4S)-5,5-dimethyl-2-phenylimino-4-propan-2-yl-1,3-oxazolidin-3-yl]-2-methylpropan-1-one (PubChem CID 101435614) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-[(4S)-5,5-dimethyl-2-phenylimino-4-propan-2-yl-1,3-oxazolidin-3-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(4S)-5,5-dimethyl-2-phenylimino-4-propan-2-yl-1,3-oxazolidin-3-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 101435614 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1-[(4S)-5,5-dimethyl-2-phenylimino-4-propan-2-yl-1,3-oxazolidin-3-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1/C(=N/c2ccccc2)OC(C)(C)[C@@H]1C(C)C |
| InChI | InChI=1S/C18H26N2O2/c1-12(2)15-18(5,6)22-17(20(15)16(21)13(3)4)19-14-10-8-7-9-11-14/h7-13,15H,1-6H3/b19-17-/t15-/m0/s1 |
| InChIKey | NQBMZYCAPVLROS-DXQAYGFFSA-N |
| XLogP | 3.99 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|