C20H30N2O2 — CID 101435620
(2R)-1-[(4S)-5,5-dimethyl-2-phenylimino-4-propan-2-yl-1,3-oxazolidin-3-yl]-2-methylpentan-1-one (PubChem CID 101435620) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is (2R)-1-[(4S)-5,5-dimethyl-2-phenylimino-4-propan-2-yl-1,3-oxazolidin-3-yl]-2-methylpentan-1-one.
| Compound Name | (2R)-1-[(4S)-5,5-dimethyl-2-phenylimino-4-propan-2-yl-1,3-oxazolidin-3-yl]-2-methylpentan-1-one |
|---|---|
| PubChem CID | 101435620 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | (2R)-1-[(4S)-5,5-dimethyl-2-phenylimino-4-propan-2-yl-1,3-oxazolidin-3-yl]-2-methylpentan-1-one |
| SMILES | CCC[C@@H](C)C(=O)N1/C(=N/c2ccccc2)OC(C)(C)[C@@H]1C(C)C |
| InChI | InChI=1S/C20H30N2O2/c1-7-11-15(4)18(23)22-17(14(2)3)20(5,6)24-19(22)21-16-12-9-8-10-13-16/h8-10,12-15,17H,7,11H2,1-6H3/b21-19-/t15-,17+/m1/s1 |
| InChIKey | AUHQHFZJAZFMCE-PMFSDDQESA-N |
| XLogP | 4.77 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|