C26H21NO4 — CID 101437550
2-cyanoethyl 3-[6-hydroxy-5-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]propanoate (PubChem CID 101437550) has the molecular formula C26H21NO4 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-cyanoethyl 3-[6-hydroxy-5-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]propanoate.
| Compound Name | 2-cyanoethyl 3-[6-hydroxy-5-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 101437550 |
| Molecular Formula | C26H21NO4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-cyanoethyl 3-[6-hydroxy-5-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]propanoate |
| SMILES | N#CCCOC(=O)CCc1ccc2c(-c3c(O)ccc4ccccc34)c(O)ccc2c1 |
| InChI | InChI=1S/C26H21NO4/c27-14-3-15-31-24(30)13-7-17-6-10-21-19(16-17)9-12-23(29)26(21)25-20-5-2-1-4-18(20)8-11-22(25)28/h1-2,4-6,8-12,16,28-29H,3,7,13,15H2 |
| InChIKey | NAJIDTPEXZHAPF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|