C22H23NO2 — CID 101437573
1-cyclohexyl-5-hydroxy-3,5-diphenylpyrrol-2-one (PubChem CID 101437573) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 1-cyclohexyl-5-hydroxy-3,5-diphenylpyrrol-2-one.
| Compound Name | 1-cyclohexyl-5-hydroxy-3,5-diphenylpyrrol-2-one |
|---|---|
| PubChem CID | 101437573 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 1-cyclohexyl-5-hydroxy-3,5-diphenylpyrrol-2-one |
| SMILES | O=C1C(c2ccccc2)=CC(O)(c2ccccc2)N1C1CCCCC1 |
| InChI | InChI=1S/C22H23NO2/c24-21-20(17-10-4-1-5-11-17)16-22(25,18-12-6-2-7-13-18)23(21)19-14-8-3-9-15-19/h1-2,4-7,10-13,16,19,25H,3,8-9,14-15H2 |
| InChIKey | SHKPTWJQCYBBQF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |