C14H23N — CID 101437995
(2S)-2-methyl-2-[(E,2S)-3-methylpent-3-en-2-yl]hept-6-enenitrile (PubChem CID 101437995) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (2S)-2-methyl-2-[(E,2S)-3-methylpent-3-en-2-yl]hept-6-enenitrile.
| Compound Name | (2S)-2-methyl-2-[(E,2S)-3-methylpent-3-en-2-yl]hept-6-enenitrile |
|---|---|
| PubChem CID | 101437995 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (2S)-2-methyl-2-[(E,2S)-3-methylpent-3-en-2-yl]hept-6-enenitrile |
| SMILES | C=CCCC[C@](C)(C#N)[C@@H](C)/C(C)=C/C |
| InChI | InChI=1S/C14H23N/c1-6-8-9-10-14(5,11-15)13(4)12(3)7-2/h6-7,13H,1,8-10H2,2-5H3/b12-7+/t13-,14+/m0/s1 |
| InChIKey | UHXCAHLNNGIFOK-NAICIEFVSA-N |
| XLogP | 4.47 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|