C17H20O4 — CID 101438463
bis(2-methylidenebut-3-enyl) cyclopent-3-ene-1,1-dicarboxylate (PubChem CID 101438463) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is bis(2-methylidenebut-3-enyl) cyclopent-3-ene-1,1-dicarboxylate.
| Compound Name | bis(2-methylidenebut-3-enyl) cyclopent-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101438463 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | bis(2-methylidenebut-3-enyl) cyclopent-3-ene-1,1-dicarboxylate |
| SMILES | C=CC(=C)COC(=O)C1(C(=O)OCC(=C)C=C)CC=CC1 |
| InChI | InChI=1S/C17H20O4/c1-5-13(3)11-20-15(18)17(9-7-8-10-17)16(19)21-12-14(4)6-2/h5-8H,1-4,9-12H2 |
| InChIKey | RKGXQILJCTVHIF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|