C29H35N5O2S2 — CID 10143946
4-cyclohexyl-2-methylsulfanyl-5-[2-[3-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-4-yl]thiophene-3-carbonitrile (PubChem CID 10143946) has the molecular formula C29H35N5O2S2 and a molecular weight of 549.77 g/mol. Its IUPAC name is 4-cyclohexyl-2-methylsulfanyl-5-[2-[3-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-4-yl]thiophene-3-carbonitrile.
| Compound Name | 4-cyclohexyl-2-methylsulfanyl-5-[2-[3-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-4-yl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 10143946 |
| Molecular Formula | C29H35N5O2S2 |
| Molecular Weight | 549.77 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 4-cyclohexyl-2-methylsulfanyl-5-[2-[3-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-4-yl]thiophene-3-carbonitrile |
| SMILES | CSc1sc(-c2ccnc(Nc3cccc(OCCCN4CCOCC4)c3)n2)c(C2CCCCC2)c1C#N |
| InChI | InChI=1S/C29H35N5O2S2/c1-37-28-24(20-30)26(21-7-3-2-4-8-21)27(38-28)25-11-12-31-29(33-25)32-22-9-5-10-23(19-22)36-16-6-13-34-14-17-35-18-15-34/h5,9-12,19,21H,2-4,6-8,13-18H2,1H3,(H,31,32,33) |
| InChIKey | XGDYSIXOFXRPCM-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.77 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|