C31H34F3N5O4S — CID 143407611
4-(5-methylthiophen-2-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrimidin-2-amine;N-[[3-(trifluoromethoxy)phenyl]methyl]formamide (PubChem CID 143407611) has the molecular formula C31H34F3N5O4S and a molecular weight of 629.71 g/mol. Its IUPAC name is 4-(5-methylthiophen-2-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrimidin-2-amine;N-[[3-(trifluoromethoxy)phenyl]methyl]formamide.
| Compound Name | 4-(5-methylthiophen-2-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrimidin-2-amine;N-[[3-(trifluoromethoxy)phenyl]methyl]formamide |
|---|---|
| PubChem CID | 143407611 |
| Molecular Formula | C31H34F3N5O4S |
| Molecular Weight | 629.71 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | 4-(5-methylthiophen-2-yl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrimidin-2-amine;N-[[3-(trifluoromethoxy)phenyl]methyl]formamide |
| SMILES | Cc1ccc(-c2ccnc(Nc3cccc(OCCCN4CCOCC4)c3)n2)s1.O=CNCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C22H26N4O2S.C9H8F3NO2/c1-17-6-7-21(29-17)20-8-9-23-22(25-20)24-18-4-2-5-19(16-18)28-13-3-10-26-11-14-27-15-12-26;10-9(11,12)15-8-3-1-2-7(4-8)5-13-6-14/h2,4-9,16H,3,10-15H2,1H3,(H,23,24,25);1-4,6H,5H2,(H,13,14) |
| InChIKey | SOLSYQJQMNEMAU-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.71 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|