C38H38F8O2S2 — CID 101439566
1-butoxy-4-[4-[[4-[[4-(4-butoxyphenyl)phenyl]methylsulfanyl]-1,1,2,2,3,3,4,4-octafluorobutyl]sulfanylmethyl]phenyl]benzene (PubChem CID 101439566) has the molecular formula C38H38F8O2S2 and a molecular weight of 742.84 g/mol. Its IUPAC name is 1-butoxy-4-[4-[[4-[[4-(4-butoxyphenyl)phenyl]methylsulfanyl]-1,1,2,2,3,3,4,4-octafluorobutyl]sulfanylmethyl]phenyl]benzene.
| Compound Name | 1-butoxy-4-[4-[[4-[[4-(4-butoxyphenyl)phenyl]methylsulfanyl]-1,1,2,2,3,3,4,4-octafluorobutyl]sulfanylmethyl]phenyl]benzene |
|---|---|
| PubChem CID | 101439566 |
| Molecular Formula | C38H38F8O2S2 |
| Molecular Weight | 742.84 g/mol |
| Exact Mass | 742.22 |
| IUPAC Name | 1-butoxy-4-[4-[[4-[[4-(4-butoxyphenyl)phenyl]methylsulfanyl]-1,1,2,2,3,3,4,4-octafluorobutyl]sulfanylmethyl]phenyl]benzene |
| SMILES | CCCCOc1ccc(-c2ccc(CSC(F)(F)C(F)(F)C(F)(F)C(F)(F)SCc3ccc(-c4ccc(OCCCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H38F8O2S2/c1-3-5-23-47-33-19-15-31(16-20-33)29-11-7-27(8-12-29)25-49-37(43,44)35(39,40)36(41,42)38(45,46)50-26-28-9-13-30(14-10-28)32-17-21-34(22-18-32)48-24-6-4-2/h7-22H,3-6,23-26H2,1-2H3 |
| InChIKey | RMDHIXGIEBKZJM-UHFFFAOYSA-N |
| XLogP | 13.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.84 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|