C31H21S — CID 10144300
CID 10144300 (PubChem CID 10144300) has the molecular formula C31H21S and a molecular weight of 425.58 g/mol.
| Compound Name | CID 10144300 |
|---|---|
| PubChem CID | 10144300 |
| Molecular Formula | C31H21S |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | — |
| SMILES | C[C]1[CH][CH][C](C#Cc2ccc(C#Cc3ccc(C#Cc4ccc(S)cc4)cc3C)cc2)[CH]1 |
| InChI | InChI=1S/C31H21S/c1-23-3-4-28(21-23)11-9-25-5-7-26(8-6-25)13-17-30-18-14-29(22-24(30)2)12-10-27-15-19-31(32)20-16-27/h3-8,14-16,18-22,32H,1-2H3 |
| InChIKey | LVZTYXCXAUVMHO-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|