C49H42FeSSi+2 — CID 10605094
CID 10605094 (PubChem CID 10605094) has the molecular formula C49H42FeSSi+2 and a molecular weight of 746.87 g/mol.
| Compound Name | CID 10605094 |
|---|---|
| PubChem CID | 10605094 |
| Molecular Formula | C49H42FeSSi+2 |
| Molecular Weight | 746.87 g/mol |
| Exact Mass | 746.21 |
| IUPAC Name | — |
| SMILES | Cc1cc(C#Cc2ccc(SCCC[Si](C)(C)C)cc2)ccc1C#Cc1ccc(C#Cc2ccc(C#C[C]3[CH][CH][CH][CH]3)cc2)cc1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C44H37SSi.C5H5.Fe/c1-35-34-42(23-22-41-26-30-44(31-27-41)45-32-7-33-46(2,3)4)25-29-43(35)28-24-40-20-18-39(19-21-40)17-16-38-14-12-37(13-15-38)11-10-36-8-5-6-9-36;1-2-4-5-3-1;/h5-6,8-9,12-15,18-21,25-27,29-31,34H,7,32-33H2,1-4H3;1-5H;/q;;+2 |
| InChIKey | KCAMXEPHTHMRSB-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.87 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|