C32H48O6 — CID 101443071
dioctyl (3aS,7aS)-1,5-dimethyl-4,8-dioxo-2,3,6,7-tetrahydro-s-indacene-3a,7a-dicarboxylate (PubChem CID 101443071) has the molecular formula C32H48O6 and a molecular weight of 528.73 g/mol. Its IUPAC name is dioctyl (3aS,7aS)-1,5-dimethyl-4,8-dioxo-2,3,6,7-tetrahydro-s-indacene-3a,7a-dicarboxylate.
| Compound Name | dioctyl (3aS,7aS)-1,5-dimethyl-4,8-dioxo-2,3,6,7-tetrahydro-s-indacene-3a,7a-dicarboxylate |
|---|---|
| PubChem CID | 101443071 |
| Molecular Formula | C32H48O6 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | dioctyl (3aS,7aS)-1,5-dimethyl-4,8-dioxo-2,3,6,7-tetrahydro-s-indacene-3a,7a-dicarboxylate |
| SMILES | CCCCCCCCOC(=O)[C@@]12CCC(C)=C1C(=O)[C@]1(C(=O)OCCCCCCCC)CCC(C)=C1C2=O |
| InChI | InChI=1S/C32H48O6/c1-5-7-9-11-13-15-21-37-29(35)31-19-17-23(3)25(31)28(34)32(20-18-24(4)26(32)27(31)33)30(36)38-22-16-14-12-10-8-6-2/h5-22H2,1-4H3/t31-,32-/m0/s1 |
| InChIKey | NDNXQZVAQJUFBU-ACHIHNKUSA-N |
| XLogP | 7.14 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|