C17H20O5 — CID 101444600
diethyl (E,4E)-4-(1-hydroxyethylidene)-3-phenylpent-2-enedioate (PubChem CID 101444600) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is diethyl (E,4E)-4-(1-hydroxyethylidene)-3-phenylpent-2-enedioate.
| Compound Name | diethyl (E,4E)-4-(1-hydroxyethylidene)-3-phenylpent-2-enedioate |
|---|---|
| PubChem CID | 101444600 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | diethyl (E,4E)-4-(1-hydroxyethylidene)-3-phenylpent-2-enedioate |
| SMILES | CCOC(=O)/C=C(C(/C(=O)OCC)=C(/C)O)\c1ccccc1 |
| InChI | InChI=1S/C17H20O5/c1-4-21-15(19)11-14(13-9-7-6-8-10-13)16(12(3)18)17(20)22-5-2/h6-11,18H,4-5H2,1-3H3/b14-11+,16-12+ |
| InChIKey | PENPRPJGRZUWLL-MHMBTURYSA-N |
| XLogP | 3.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|