C19H22O6 — CID 102274076
triethyl (1Z,3E)-3-phenylbuta-1,3-diene-1,2,4-tricarboxylate (PubChem CID 102274076) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is triethyl (1Z,3E)-3-phenylbuta-1,3-diene-1,2,4-tricarboxylate.
| Compound Name | triethyl (1Z,3E)-3-phenylbuta-1,3-diene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 102274076 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | triethyl (1Z,3E)-3-phenylbuta-1,3-diene-1,2,4-tricarboxylate |
| SMILES | CCOC(=O)/C=C(C(=O)OCC)/C(=C/C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C19H22O6/c1-4-23-17(20)12-15(14-10-8-7-9-11-14)16(19(22)25-6-3)13-18(21)24-5-2/h7-13H,4-6H2,1-3H3/b15-12+,16-13- |
| InChIKey | WPUPYAXFVDKQBO-SWPSDAPNSA-N |
| XLogP | 2.69 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|