C23H26O5 — CID 101444897
6-O-butyl 1-O-ethyl (2Z,4E)-3-(2-methoxynaphthalen-1-yl)hexa-2,4-dienedioate (PubChem CID 101444897) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is 6-O-butyl 1-O-ethyl (2Z,4E)-3-(2-methoxynaphthalen-1-yl)hexa-2,4-dienedioate.
| Compound Name | 6-O-butyl 1-O-ethyl (2Z,4E)-3-(2-methoxynaphthalen-1-yl)hexa-2,4-dienedioate |
|---|---|
| PubChem CID | 101444897 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 6-O-butyl 1-O-ethyl (2Z,4E)-3-(2-methoxynaphthalen-1-yl)hexa-2,4-dienedioate |
| SMILES | CCCCOC(=O)/C=C/C(=C/C(=O)OCC)c1c(OC)ccc2ccccc12 |
| InChI | InChI=1S/C23H26O5/c1-4-6-15-28-21(24)14-12-18(16-22(25)27-5-2)23-19-10-8-7-9-17(19)11-13-20(23)26-3/h7-14,16H,4-6,15H2,1-3H3/b14-12+,18-16- |
| InChIKey | SRSBPIJVOYKJGC-IMOQJAIBSA-N |
| XLogP | 4.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|