C20H22BrN3O6S2 — CID 101444936
N-[5-bromo-7-[(4-nitrophenyl)sulfonylamino]hept-3-ynyl]-4-methylbenzenesulfonamide (PubChem CID 101444936) has the molecular formula C20H22BrN3O6S2 and a molecular weight of 544.45 g/mol. Its IUPAC name is N-[5-bromo-7-[(4-nitrophenyl)sulfonylamino]hept-3-ynyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[5-bromo-7-[(4-nitrophenyl)sulfonylamino]hept-3-ynyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101444936 |
| Molecular Formula | C20H22BrN3O6S2 |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 543.01 |
| IUPAC Name | N-[5-bromo-7-[(4-nitrophenyl)sulfonylamino]hept-3-ynyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC#CC(Br)CCNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H22BrN3O6S2/c1-16-5-9-19(10-6-16)31(27,28)22-14-3-2-4-17(21)13-15-23-32(29,30)20-11-7-18(8-12-20)24(25)26/h5-12,17,22-23H,3,13-15H2,1H3 |
| InChIKey | TTWLQHWCTLBDRH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|