C28H35N3O5 — CID 101446849
methyl 4-[cyclohexyl-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]amino]-3-nitrobenzoate (PubChem CID 101446849) has the molecular formula C28H35N3O5 and a molecular weight of 493.60 g/mol. Its IUPAC name is methyl 4-[cyclohexyl-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]amino]-3-nitrobenzoate.
| Compound Name | methyl 4-[cyclohexyl-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]amino]-3-nitrobenzoate |
|---|---|
| PubChem CID | 101446849 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | methyl 4-[cyclohexyl-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]amino]-3-nitrobenzoate |
| SMILES | COC(=O)c1ccc(N(C2CCCCC2)C(C(=O)NC2CCCCC2)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H35N3O5/c1-36-28(33)21-17-18-24(25(19-21)31(34)35)30(23-15-9-4-10-16-23)26(20-11-5-2-6-12-20)27(32)29-22-13-7-3-8-14-22/h2,5-6,11-12,17-19,22-23,26H,3-4,7-10,13-16H2,1H3,(H,29,32) |
| InChIKey | JOACKGPIOMSVDR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|